For research use only. Not for therapeutic Use.
Y-27632（Cat No.:I001786）is a selective inhibitor of Rho-associated protein kinase (ROCK), which plays a critical role in regulating cell shape, motility, and contraction by influencing the actin cytoskeleton. By inhibiting ROCK, Y-27632 promotes cell relaxation, reduces cell contraction, and enhances cell survival, particularly in stem cell and tissue culture research. It is commonly used to prevent dissociation-induced apoptosis (anoikis) in stem cells and to study cellular processes related to cytoskeletal dynamics. Y-27632 has applications in cancer research, tissue engineering, and regenerative medicine.
| Catalog Number | I001786 |
| CAS Number | 146986-50-7 |
| Synonyms | 4-[(1R)-1-aminoethyl]-N-pyridin-4-ylcyclohexane-1-carboxamide |
| Molecular Formula | C₁₄H₂₁N₃O.2HCl |
| Purity | ≥95% |
| Target | ROCK |
| Solubility | DMSO: ≥ 32 mg/mL |
| Storage | Store at -20C |
| Related CAS | 129830-38-2(hydrochloride) |
| IC50 | 140 nM (Ki) |
| IUPAC Name | 4-[(1R)-1-aminoethyl]-N-pyridin-4-ylcyclohexane-1-carboxamide |
| InChI | InChI=1S/C14H21N3O/c1-10(15)11-2-4-12(5-3-11)14(18)17-13-6-8-16-9-7-13/h6-12H,2-5,15H2,1H3,(H,16,17,18)/t10-,11?,12?/m1/s1 |
| InChIKey | IYOZTVGMEWJPKR-VOMCLLRMSA-N |
| SMILES | C[C@H](C1CCC(CC1)C(=O)NC2=CC=NC=C2)N |
| Reference | <p> |
