For research use only. Not for therapeutic Use.
Yatein(CAT: R014005) is a natural diterpenoid isolated from the heartwood of Podocarpus nagi, a species of coniferous trees. It is a bioactive compound with potential therapeutic properties, including anticancer, anti-inflammatory, and antimicrobial activities. Yatein has been studied for its ability to inhibit the growth of various cancer cells, and it plays a role in apoptosis induction and cell cycle arrest. Additionally, it has demonstrated potential in modulating immune responses, making it a compound of interest in the development of novel pharmacological agents for both cancer therapy and immune regulation research.
CAS Number | 40456-50-6 |
Molecular Formula | C22H24O7 |
Purity | 96% |
Target | Apoptosis |
Appearance | Solid powder |
Storage | -20°C |
IUPAC Name | (3R,4R)-4-(1,3-benzodioxol-5-ylmethyl)-3-[(3,4,5-trimethoxyphenyl)methyl]oxolan-2-one |
InChI | InChI=1S/C22H24O7/c1-24-19-9-14(10-20(25-2)21(19)26-3)7-16-15(11-27-22(16)23)6-13-4-5-17-18(8-13)29-12-28-17/h4-5,8-10,15-16H,6-7,11-12H2,1-3H3/t15-,16+/m0/s1 |
InChIKey | GMLDZDDTZKXJLU-JKSUJKDBSA-N |
SMILES | COC1=CC(=CC(=C1OC)OC)CC2C(COC2=O)CC3=CC4=C(C=C3)OCO4 |