For research use only. Not for therapeutic Use.
YC-001（Cat No.:I043928）is a selective small molecule inhibitor that targets the protein CD73, an enzyme involved in the production of adenosine from AMP (adenosine monophosphate). By inhibiting CD73, YC-001 reduces adenosine signaling, which is associated with immune suppression in the tumor microenvironment. This makes YC-001 a promising candidate for cancer immunotherapy, as it may enhance anti-tumor immune responses by reversing adenosine-mediated immune evasion. Preclinical studies suggest that YC-001 could improve the efficacy of immune checkpoint inhibitors, offering a novel approach to enhancing immune system activity against cancer cells.
| CAS Number | 748778-73-6 |
| Synonyms | 3-(5-chlorothiophen-2-yl)-4-thiophen-2-yl-2H-furan-5-one |
| Molecular Formula | C12H7ClO2S2 |
| Purity | ≥95% |
| IUPAC Name | 3-(5-chlorothiophen-2-yl)-4-thiophen-2-yl-2H-furan-5-one |
| InChI | InChI=1S/C12H7ClO2S2/c13-10-4-3-8(17-10)7-6-15-12(14)11(7)9-2-1-5-16-9/h1-5H,6H2 |
| InChIKey | RCLLWMPOHNZNAO-UHFFFAOYSA-N |
| SMILES | C1C(=C(C(=O)O1)C2=CC=CS2)C3=CC=C(S3)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
