For research use only. Not for therapeutic Use.
YD23(Cat No.:I041365)is a small molecule compound that is studied for its potential in modulating specific biological pathways, particularly in the context of cancer and inflammation. It has been identified as a potential inhibitor of certain signaling pathways that regulate cell growth, survival, and immune responses. YD23 is being investigated for its ability to target specific proteins involved in disease progression, including those linked to tumorigenesis and chronic inflammatory conditions. Ongoing research aims to evaluate its pharmacological properties, efficacy, and safety, with the goal of developing it as a therapeutic agent for various diseases.
CAS Number | 2951015-29-3 |
Synonyms | 4-[2-[2-[4-[[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperazin-1-yl]methyl]-2-fluorophenoxy]ethoxy]ethylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
Molecular Formula | C38H39FN8O7 |
Purity | ≥95% |
IUPAC Name | 4-[2-[2-[4-[[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperazin-1-yl]methyl]-2-fluorophenoxy]ethoxy]ethylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
InChI | InChI=1S/C38H39FN8O7/c39-26-20-23(22-45-13-15-46(16-14-45)30-21-28(43-44-35(30)40)24-4-1-2-7-31(24)48)8-10-32(26)54-19-18-53-17-12-41-27-6-3-5-25-34(27)38(52)47(37(25)51)29-9-11-33(49)42-36(29)50/h1-8,10,20-21,29,41,48H,9,11-19,22H2,(H2,40,44)(H,42,49,50) |
InChIKey | DMUYROJVOXZRNE-UHFFFAOYSA-N |
SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)NCCOCCOC4=C(C=C(C=C4)CN5CCN(CC5)C6=CC(=NN=C6N)C7=CC=CC=C7O)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |