For research use only. Not for therapeutic Use.
YH239-EE(Cat No.:I001402) is the ethyl ester derivative of the carboxylic acid compound YH239. It exhibits potent activity as a p53-MDM2 antagonist, meaning it interferes with the interaction between p53 and MDM2 proteins. By antagonizing MDM2, YH239-EE promotes the activation of p53, a tumor suppressor protein involved in regulating cell growth and apoptosis. Consequently, YH239-EE demonstrates the ability to induce apoptosis, or programmed cell death, highlighting its potential as an anticancer agent.
CAS Number | 1364488-67-4 |
Synonyms | Ethyl 3-(2-(tert-butylamino)-1-(N-(4-chlorobenzyl)formamido)-2-oxoethyl)-6-chloro-1H-indole-2-carboxylate |
Molecular Formula | C₂₅H₂₇Cl₂N₃O₄ |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Solubility | DMSO: ≥ 55 mg/mL |
Storage | Desiccate at -20C |
IUPAC Name | ethyl 3-[2-(tert-butylamino)-1-[(4-chlorophenyl)methyl-formylamino]-2-oxoethyl]-6-chloro-1H-indole-2-carboxylate |
InChI | InChI=1S/C25H27Cl2N3O4/c1-5-34-24(33)21-20(18-11-10-17(27)12-19(18)28-21)22(23(32)29-25(2,3)4)30(14-31)13-15-6-8-16(26)9-7-15/h6-12,14,22,28H,5,13H2,1-4H3,(H,29,32) |
InChIKey | OTUBDDRFPQLPKD-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=C(C2=C(N1)C=C(C=C2)Cl)C(C(=O)NC(C)(C)C)N(CC3=CC=C(C=C3)Cl)C=O |
Reference | <p style=/line-height:25px/> |