For research use only. Not for therapeutic Use.
YM-244769（Cat No.:I012107）is a selective small molecule inhibitor that targets the GPR119 receptor, a G-protein coupled receptor involved in regulating glucose and lipid metabolism. By activating GPR119, YM-244769 stimulates the release of insulin in a glucose-dependent manner, making it a potential therapeutic agent for type 2 diabetes and other metabolic disorders. Preclinical studies have shown that YM-244769 can improve glucose tolerance and reduce blood sugar levels. Its ability to modulate insulin secretion offers a novel approach in managing diabetes and related metabolic conditions, presenting potential benefits for glucose homeostasis.
| CAS Number | 838819-70-8 |
| Synonyms | N-[(3-aminophenyl)methyl]-6-[4-[(3-fluorophenyl)methoxy]phenoxy]pyridine-3-carboxamide |
| Molecular Formula | C26H22FN3O3 |
| Purity | ≥95% |
| IUPAC Name | N-[(3-aminophenyl)methyl]-6-[4-[(3-fluorophenyl)methoxy]phenoxy]pyridine-3-carboxamide |
| InChI | InChI=1S/C26H22FN3O3/c27-21-5-1-4-19(13-21)17-32-23-8-10-24(11-9-23)33-25-12-7-20(16-29-25)26(31)30-15-18-3-2-6-22(28)14-18/h1-14,16H,15,17,28H2,(H,30,31) |
| InChIKey | JZMLHJRKSJXARY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)CNC(=O)C2=CN=C(C=C2)OC3=CC=C(C=C3)OCC4=CC(=CC=C4)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
