For research use only. Not for therapeutic Use.
YM-53601（Cat No.:R065710）is a selective squalene synthase inhibitor, primarily researched for its ability to reduce cholesterol biosynthesis by blocking the first committed step in the sterol synthesis pathway. By inhibiting squalene synthase, YM-53601 prevents the conversion of farnesyl diphosphate into squalene, thereby reducing downstream cholesterol production. This compound is valuable in studying cholesterol metabolism and has potential therapeutic applications in managing hypercholesterolemia and related cardiovascular diseases. YM-53601’s targeted action allows researchers to explore metabolic pathways involved in lipid regulation and cardiovascular health, supporting advancements in cholesterol-lowering therapies.
| Catalog Number | R065710 |
| CAS Number | 182959-33-7 |
| Synonyms | 2-[(2E)-2-(1-azabicyclo[2.2.2]oct-3-ylidene)-2-fluoroethoxy]-9H-carbazole, monohydrochloride |
| Molecular Formula | C21H22ClFN2O |
| Purity | ≥95% |
| Target | Anti-infection |
| Storage | -20°C |
| IUPAC Name | 2-[(2E)-2-(1-azabicyclo[2.2.2]octan-3-ylidene)-2-fluoroethoxy]-9H-carbazole;hydrochloride |
| InChI | InChI=1S/C21H21FN2O.ClH/c22-19(18-12-24-9-7-14(18)8-10-24)13-25-15-5-6-17-16-3-1-2-4-20(16)23-21(17)11-15;/h1-6,11,14,23H,7-10,12-13H2;1H/b19-18-; |
| InChIKey | JWXYVHMBPISIJQ-TVWXOORISA-N |
| SMILES | C1CN2CCC1/C(=C(/COC3=CC4=C(C=C3)C5=CC=CC=C5N4)\F)/C2.Cl |
| Reference | 1.Ugawa, T.,Kakuta, H.,Moritani, H., et al. YM-53601, a novel squalene synthase inhibitor, reduces plasma cholesterol and triglyceride levels in several animal species. British Journal of Pharmacology 131, 63-70 (2000). |
