For research use only. Not for therapeutic Use.
YU238259 (CAT: I014763) is a novel inhibitor of homology-dependent DNA repair. It specifically targets and inhibits the process of DNA repair through homologous recombination, which is an essential mechanism for maintaining genome stability. By blocking homology-dependent DNA repair, YU238259 disrupts the ability of cancer cells to effectively repair DNA damage, leading to genomic instability and potentially sensitizing the cells to other DNA-damaging treatments such as chemotherapy or radiation therapy. YU238259 holds promise as a potential therapeutic agent in the treatment of cancer.
| Catalog Number | I014763 |
| CAS Number | 1943733-16-1 |
| Synonyms | YU238259; YU-238259; YU 238259;;N-(2-(5-chloropyridin-2-yl)ethyl)-4-(((4-methoxyphenyl)sulfonamido)methyl)benzamide |
| Molecular Formula | C22H22ClN3O4S |
| Purity | ≥95% |
| Target | DNA Repair inhibitor |
| Solubility | Soluble in DMSO |
| InChI | InChI=1S/C22H22ClN3O4S/c1-30-20-8-10-21(11-9-20)31(28,29)26-14-16-2-4-17(5-3-16)22(27)24-13-12-19-7-6-18(23)15-25-19/h2-11,15,26H,12-14H2,1H3,(H,24,27) |
| InChIKey | BIHURSOREGLQBB-UHFFFAOYSA-N |
| SMILES | C1=CC(OC)=CC=C1S(=O)(=O)NCC1=CC=C(C(=O)NCCC2=CC=C(Cl)C=N2)C=C1 |
| Reference | </br>1: Stachelek GC, Peterson-Roth E, Liu Y, Fernandez RJ 3rd, Pike LR, Qian JM,</br> Abriola L, Hoyer D, Hungerford W, Merkel J, Glazer PM. YU238259 Is a Novel</br> Inhibitor of Homology-Dependent DNA Repair That Exhibits Synthetic Lethality and </br> Radiosensitization in Repair-Deficient Tumors. Mol Cancer Res. 2015</br> Oct;13(10):1389-97. doi: 10.1158/1541-7786.MCR-15-0036. Epub 2015 Jun 26. PubMed </br> PMID: 26116172; PubMed Central PMCID: PMC4618103.</br> </br> |
