For research use only. Not for therapeutic Use.
Yuanhuacine is a bioactive diterpenoid extracted from the roots of Daphne genkwa, a plant used in traditional Chinese medicine. It has attracted attention for its potent anticancer properties, particularly its ability to induce apoptosis and inhibit proliferation in various cancer cell lines. Yuanhuacine is also known for its anti-inflammatory and anti-angiogenic effects, making it a subject of research in cancer treatment. Its complex molecular structure contributes to its biological activity, and ongoing studies aim to explore its therapeutic potential and underlying mechanisms.
| Catalog Number | I010467 |
| CAS Number | 60195-70-2 |
| Synonyms | [(1R,2R,6S,7S,8R,10S,11S,12R,14S,16S,17R,18R)-6,7-dihydroxy-8-(hydroxymethyl)-4,18-dimethyl-14-[(1E,3E)-nona-1,3-dienyl]-5-oxo-16-prop-1-en-2-yl-9,13,15,19-tetraoxahexacyclo[12.4.1.01,11.02,6.08,10.012,16]nonadec-3-en-17-yl] benzoate |
| Molecular Formula | C37H44O10 |
| Purity | ≥95% |
| InChI | InChI=1S/C37H44O10/c1-6-7-8-9-10-11-15-18-34-45-30-26-29-33(20-38,44-29)32(41)35(42)25(19-22(4)27(35)39)37(26,47-34)23(5)28(36(30,46-34)21(2)3)43-31(40)24-16-13-12-14-17-24/h10-19,23,25-26,28-30,32,38,41-42H,2,6-9,20H2,1,3-5H3/b11-10+,18-15+/t23-,25-,26+,28-,29+,30-,32-,33+,34-,35-,36+,37+/m1/s1 |
| InChIKey | CGSGRJNIABXQJQ-NSCQCFIPSA-N |
| SMILES | CCCCCC=CC=CC12OC3C4C5C(O5)(C(C6(C(C4(O1)C(C(C3(O2)C(=C)C)OC(=O)C7=CC=CC=C7)C)C=C(C6=O)C)O)O)CO |
