For research use only. Not for therapeutic Use.
(Z)-4-Amino-4-oxobut-2-enoic acid(Cat No.:I018066) is an endogenous metabolite, meaning it is a naturally occurring compound produced within the body as part of normal metabolic processes. It is a derivative of the amino acid glutamate. This metabolite plays important roles in various biological pathways and is involved in several physiological processes. It may have specific functions in neurotransmission, energy metabolism, and cellular signaling.
CAS Number | 557-24-4 |
Molecular Formula | C₄H₅NO₃ |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | Room Temperature |
IUPAC Name | (Z)-4-amino-4-oxobut-2-enoic acid |
InChI | InChI=1S/C4H5NO3/c5-3(6)1-2-4(7)8/h1-2H,(H2,5,6)(H,7,8)/b2-1- |
InChIKey | FSQQTNAZHBEJLS-UPHRSURJSA-N |
SMILES | C(=CC(=O)O)C(=O)N |