For research use only. Not for therapeutic Use.
Z-Arg(NO2)-OH(Cat No.:L006919), is a derivative of the amino acid arginine. It is a compound with a specific structural modification where the amino group of arginine is protected by the Z (benzyloxycarbonyl) group, and the terminal amino group is converted into a nitro group (-NO2). This modification is commonly employed in peptide synthesis to enhance selectivity and control during chemical reactions. The Z-Arg(NO2)-OH derivative acts as a key intermediate in the preparation of customized peptides for research purposes, particularly in the field of biochemistry, allowing scientists to study the structure and function of proteins and enzymes.
CAS Number | 2304-98-5 |
Molecular Formula | C14H19N5O6 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | (2S)-5-[[amino(nitramido)methylidene]amino]-2-(phenylmethoxycarbonylamino)pentanoic acid |
InChI | InChI=1S/C14H19N5O6/c15-13(18-19(23)24)16-8-4-7-11(12(20)21)17-14(22)25-9-10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9H2,(H,17,22)(H,20,21)(H3,15,16,18)/t11-/m0/s1 |
InChIKey | BZPCSFNCKORLQG-NSHDSACASA-N |
SMILES | C1=CC=C(C=C1)COC(=O)NC(CCCN=C(N)N[N+](=O)[O-])C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |