For research use only. Not for therapeutic Use.
Z-GLY-PRO-GLY-GLY-PRO-ALA-OH(Cat No.:M063750) is a peptide with a complex yet fascinating structure. Comprising amino acids glycine (GLY), proline (PRO), and alanine (ALA), it exhibits a unique sequence that influences its biological functions. The presence of proline introduces rigidity to the peptide chain, affecting its conformation and potentially its interaction with other molecules. Such peptides might play crucial roles in biological processes, serving as signaling molecules or substrates for enzymatic reactions.
CAS Number | 13075-38-2 |
Molecular Formula | C27H36N6O9 |
Purity | ≥95% |
Storage | Store at +4C |
IUPAC Name | (2S)-2-[[(2S)-1-[2-[[2-[[(2S)-1-[2-(phenylmethoxycarbonylamino)acetyl]pyrrolidine-2-carbonyl]amino]acetyl]amino]acetyl]pyrrolidine-2-carbonyl]amino]propanoic acid |
InChI | InChI=1S/C27H36N6O9/c1-17(26(39)40)31-25(38)20-10-6-12-33(20)22(35)14-28-21(34)13-29-24(37)19-9-5-11-32(19)23(36)15-30-27(41)42-16-18-7-3-2-4-8-18/h2-4,7-8,17,19-20H,5-6,9-16H2,1H3,(H,28,34)(H,29,37)(H,30,41)(H,31,38)(H,39,40)/t17-,19-,20-/m0/s1 |
InChIKey | YMMPZCZOLKBHAP-IHPCNDPISA-N |
SMILES | CC(C(=O)O)NC(=O)C1CCCN1C(=O)CNC(=O)CNC(=O)C2CCCN2C(=O)CNC(=O)OCC3=CC=CC=C3 |