For research use only. Not for therapeutic Use.
(Z)-JIB-04 (NSC693627) is the Z isomer of JIB-04 that has two forms, E (HY-13953) and Z isomers. (Z)-JIB-04 is inactive in epigenetic analysis[1].
JIB-04 inhibits the demethylase activity of Jumonji enzymes in vitro and in cells, without affecting other α-ketoglutarate dependent hydroxylases or histone modifying enzymes [1].
| Catalog Number | I007413 |
| CAS Number | 199596-24-2 |
| Synonyms | 5-chloro-N-[(Z)-[phenyl(pyridin-2-yl)methylidene]amino]pyridin-2-amine |
| Molecular Formula | C17H13ClN4 |
| Purity | ≥95% |
| InChI | InChI=1S/C17H13ClN4/c18-14-9-10-16(20-12-14)21-22-17(13-6-2-1-3-7-13)15-8-4-5-11-19-15/h1-12H,(H,20,21)/b22-17- |
| InChIKey | YHHFKWKMXWRVTJ-XLNRJJMWSA-N |
| SMILES | C1=CC=C(C=C1)C(=NNC2=NC=C(C=C2)Cl)C3=CC=CC=N3 |
| Reference | [1]. Wang L, et al. A small molecule modulates Jumonji histone demethylase activity and selectively inhibits cancer growth. Nat Commun. 2013;4:2035. |
