For research use only. Not for therapeutic Use.
Z-Lys(Z)-OSu(Cat No.:I042994)is a chemical compound commonly used in peptide synthesis and biochemistry. It consists of the amino acid lysine (Lys) with a Z-protecting group on its amino group, and an N-hydroxy-succinimide ester (OSu) attached to the carboxyl group. The Z-protecting group stabilizes the lysine during peptide chain elongation, while the OSu ester facilitates the coupling of the lysine residue with other peptides or molecules. Z-Lys(Z)-OSu is useful in the production of peptides for research, diagnostics, and therapeutic applications.
CAS Number | 21160-83-8 |
Synonyms | (2,5-dioxopyrrolidin-1-yl) (2S)-2,6-bis(phenylmethoxycarbonylamino)hexanoate |
Molecular Formula | C26H29N3O8 |
Purity | ≥95% |
IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (2S)-2,6-bis(phenylmethoxycarbonylamino)hexanoate |
InChI | InChI=1S/C26H29N3O8/c30-22-14-15-23(31)29(22)37-24(32)21(28-26(34)36-18-20-11-5-2-6-12-20)13-7-8-16-27-25(33)35-17-19-9-3-1-4-10-19/h1-6,9-12,21H,7-8,13-18H2,(H,27,33)(H,28,34)/t21-/m0/s1 |
InChIKey | LHOAUCZIIQFZMI-NRFANRHFSA-N |
SMILES | C1CC(=O)N(C1=O)OC(=O)[C@H](CCCCNC(=O)OCC2=CC=CC=C2)NC(=O)OCC3=CC=CC=C3 |