For research use only. Not for therapeutic Use.
(Z)-N-[(3-Methoxyphenyl)methyl]octadec-9-enamide(Cat No.:R072330)is a synthetic amide compound notable for its lipid-like structure, making it a valuable tool in biochemical and pharmacological research. Its structure allows it to interact with cell membranes and potentially modulate lipid-related pathways, offering insights into lipid metabolism and signaling. Research suggests it could serve as a model compound for studying fatty acid amide interactions within biological systems, particularly those involved in signaling and membrane dynamics. Its applications extend to exploring therapeutic targets in metabolic disorders and inflammatory conditions.
Catalog Number | R072330 |
CAS Number | 883715-21-7 |
Molecular Formula | C26H43NO2 |
Purity | ≥95% |
Target | Disease Research Fields |
Storage | Store at -20°C |
IUPAC Name | (Z)-N-[(3-methoxyphenyl)methyl]octadec-9-enamide |
InChI | InChI=1S/C26H43NO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-26(28)27-23-24-19-18-20-25(22-24)29-2/h10-11,18-20,22H,3-9,12-17,21,23H2,1-2H3,(H,27,28)/b11-10- |
InChIKey | ZMKZIKHBSPDWEF-KHPPLWFESA-N |
SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NCC1=CC(=CC=C1)OC |