For research use only. Not for therapeutic Use.
(Z)-N’-Hydroxybenzimidamide hydrobromide (CAT: L000251) is a crucial compound in pharmaceutical and organic chemistry. It plays a significant role in drug development and the synthesis of pharmaceutical agents. In pharmaceutical research, it is used to introduce specific functional groups into drug candidates, influencing their biological activity and targeting processes. This compound’s applications are pivotal for creating novel pharmaceutical compounds and advancing drug discovery.
| Catalog Number | L000251 |
| CAS Number | 1195196-49-6 |
| Molecular Formula | C7H9BrN2O |
| Purity | ≥95% |
| IUPAC Name | N'-hydroxybenzenecarboximidamide;hydrobromide |
| InChI | InChI=1S/C7H8N2O.BrH/c8-7(9-10)6-4-2-1-3-5-6;/h1-5,10H,(H2,8,9);1H |
| InChIKey | XHVJSUZVSQISRA-UHFFFAOYSA-N |
