For research use only. Not for therapeutic Use.
(Z11)-Hexadecenoic acid(Cat No.:H000060), also known as (Z)-11-hexadecenoic acid, is a monounsaturated fatty acid characterized by having a double bond at the 11th carbon from the carboxyl end in the cis configuration. This specific structure places it within the group of omega-7 fatty acids. It naturally occurs in various animal and vegetable fats and oils, contributing to their chemical and physical properties. (Z11)-Hexadecenoic acid is of interest for its potential health benefits, including roles in metabolism and inflammation. It is also studied for its impact on skin health and cellular function, highlighting its significance in nutritional and cosmetic applications.
CAS Number | 2416-20-8 |
Synonyms | Z11-16CO2H; |
Molecular Formula | C16H30O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (Z)-hexadec-11-enoic acid |
InChI | InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h5-6H,2-4,7-15H2,1H3,(H,17,18)/b6-5- |
InChIKey | JGMYDQCXGIMHLL-WAYWQWQTSA-N |
SMILES | CCCCC=CCCCCCCCCCC(=O)O |