For research use only. Not for therapeutic Use.
Z16078526(CAT: I040789) is a bioactive small molecule that promotes thermogenesis by inducing endogenous Ucp1 expression and enhancing p38 MAPK phosphorylation in primary mouse brown adipocytes. It stimulates lipolysis and activates thermogenic gene programs, leading to increased mitochondrial activity and uncoupled respiration. Z16078526 effectively boosts energy expenditure and thermogenic function at the cellular level. In vivo studies in mice show that Z16078526 also enhances whole-body thermogenesis, making it a valuable tool for studying brown adipose tissue (BAT) function and metabolic regulation. This compound holds potential for research into obesity, metabolic disorders, and energy homeostasis.
| CAS Number | 852222-94-7 |
| Synonyms | N-(2,4-dimethoxyphenyl)-2-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]acetamide |
| Molecular Formula | C18H17N3O4S |
| Purity | ≥95% |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]acetamide |
| InChI | InChI=1S/C18H17N3O4S/c1-24-11-7-8-14(15(9-11)25-2)19-16(22)10-26-18-20-13-6-4-3-5-12(13)17(23)21-18/h3-9H,10H2,1-2H3,(H,19,22)(H,20,21,23) |
| InChIKey | MHSOAGHWQLCVOI-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)NC(=O)CSC2=NC3=CC=CC=C3C(=O)N2)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
