For research use only. Not for therapeutic Use.
Z4P(Cat No.:I041070)is a small molecule inhibitor that targets specific protein-protein interactions involved in the regulation of cellular processes. It has shown potential in disrupting the function of key proteins associated with various diseases, particularly in cancer and neurological disorders. By modulating pathways such as cell proliferation, apoptosis, and immune response, Z4P demonstrates efficacy in preclinical studies for reducing tumor growth and enhancing treatment responses. This compound is of interest in therapeutic development for targeted cancer therapies and neurodegenerative diseases, providing a promising avenue for precision medicine.
CAS Number | 2361760-87-2 |
Synonyms | 1-(2,5-dimethylphenyl)-3-[4-(4-hydroxyphenyl)butan-2-yl]urea |
Molecular Formula | C19H24N2O2 |
Purity | ≥95% |
IUPAC Name | 1-(2,5-dimethylphenyl)-3-[4-(4-hydroxyphenyl)butan-2-yl]urea |
InChI | InChI=1S/C19H24N2O2/c1-13-4-5-14(2)18(12-13)21-19(23)20-15(3)6-7-16-8-10-17(22)11-9-16/h4-5,8-12,15,22H,6-7H2,1-3H3,(H2,20,21,23) |
InChIKey | SWCGKGWNEOWHGC-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C=C1)C)NC(=O)NC(C)CCC2=CC=C(C=C2)O |