For research use only. Not for therapeutic Use.
Zamaporvint（Cat No.:I041064）is a novel investigational drug, still under research, which has shown promise as a potential treatment for certain neurological and metabolic disorders. Although specific details are limited, early studies suggest it may work by targeting key pathways involved in neuroprotection and inflammation, potentially offering therapeutic benefits in conditions such as neurodegenerative diseases or metabolic syndrome. Zamaporvint’s mechanism of action likely involves modulating cellular signaling and reducing oxidative stress. Further clinical trials and research are needed to fully understand its safety, efficacy, and potential applications in medical treatments.
| CAS Number | 1900754-56-4 |
| Synonyms | 2-[5-methyl-4-[2-(trifluoromethyl)pyridin-4-yl]imidazol-1-yl]-N-(5-pyrazin-2-ylpyridin-2-yl)acetamide |
| Molecular Formula | C21H16F3N7O |
| Purity | ≥95% |
| IUPAC Name | 2-[5-methyl-4-[2-(trifluoromethyl)pyridin-4-yl]imidazol-1-yl]-N-(5-pyrazin-2-ylpyridin-2-yl)acetamide |
| InChI | InChI=1S/C21H16F3N7O/c1-13-20(14-4-5-27-17(8-14)21(22,23)24)29-12-31(13)11-19(32)30-18-3-2-15(9-28-18)16-10-25-6-7-26-16/h2-10,12H,11H2,1H3,(H,28,30,32) |
| InChIKey | QMLOYDPILBUVBV-UHFFFAOYSA-N |
| SMILES | CC1=C(N=CN1CC(=O)NC2=NC=C(C=C2)C3=NC=CN=C3)C4=CC(=NC=C4)C(F)(F)F |
