For research use only. Not for therapeutic Use.
ZAPA sulfate is an agonist at low affinity GABAA-receptors. ZAPA sulfate induces membrane hyperpolarization of the Ascaris muscle cell with an EC50 of 10.3 μM[1][2].
Local applications of ZAPA (100 μM) sulfate transiently increases [Ca2+]i, similar to the GABA-evoked responses[1].
| Catalog Number | I005545 |
| CAS Number | 371962-01-5 |
| Synonyms | (Z)-3-carbamimidoylsulfanylprop-2-enoic acid;sulfuric acid |
| Molecular Formula | C4H8N2O6S2 |
| Purity | ≥95% |
| InChI | InChI=1S/C4H6N2O2S.H2O4S/c5-4(6)9-2-1-3(7)8;1-5(2,3)4/h1-2H,(H3,5,6)(H,7,8);(H2,1,2,3,4)/b2-1-; |
| InChIKey | UWVNHPNVOMFDHW-ODZAUARKSA-N |
| SMILES | C(=CSC(=N)N)C(=O)O.OS(=O)(=O)O |
