For research use only. Not for therapeutic Use.
Zastaprazan (JP-1366) is a proton pump inhibitor (WO2018008929). Zastaprazan can be used for the research of gastrointestinal inflammatory diseases or gastric acid-related diseases[1].
Zastaprazan is a proton pump inhibitor[1]
| Catalog Number | I038662 |
| CAS Number | 2133852-18-1 |
| Synonyms | azetidin-1-yl-[8-[(2,6-dimethylphenyl)methylamino]-2,3-dimethylimidazo[1,2-a]pyridin-6-yl]methanone |
| Molecular Formula | C22H26N4O |
| Purity | ≥95% |
| InChI | InChI=1S/C22H26N4O/c1-14-7-5-8-15(2)19(14)12-23-20-11-18(22(27)25-9-6-10-25)13-26-17(4)16(3)24-21(20)26/h5,7-8,11,13,23H,6,9-10,12H2,1-4H3 |
| InChIKey | FEQFUBYYZYQTOJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)CNC2=CC(=CN3C2=NC(=C3C)C)C(=O)N4CCC4 |
| Reference | [1]. WO2018008929 |
