For research use only. Not for therapeutic Use.
ZCN-75104 (CAT: I038668) serves as a crucial building block in the synthesis of peptide thrombin inhibitors. Thrombin inhibitors are compounds that specifically target the enzyme thrombin, which plays a crucial role in blood clotting. By inhibiting thrombin, these peptide-based inhibitors can help prevent or treat conditions associated with abnormal blood clotting, such as thrombosis. ZCN-75104’s utilization in the synthesis of peptide thrombin inhibitors highlights its importance as a key component in the development of potential anticoagulant therapies.
CAS Number | 38675-10-4 |
Synonyms | ZCN-75104; ZCN75104; ZCN 75104; Boc-D-Phe-Pro-OH; Boc-D-FP-OH; |
Molecular Formula | C19H26N2O5 |
Purity | 98% |
Solubility | To be determined |
Appearance | Solid powder |
Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
IUPAC Name | (tert-butoxycarbonyl)-D-phenylalanyl-L-proline |
InChI | InChI=1S/C19H26N2O5/c1-19(2,3)26-18(25)20-14(12-13-8-5-4-6-9-13)16(22)21-11-7-10-15(21)17(23)24/h4-6,8-9,14-15H,7,10-12H2,1-3H3,(H,20,25)(H,23,24)/t14-,15+/m1/s1 |
InChIKey | ZPRHVPHDENDZTP-CABCVRRESA-N |
SMILES | O=C([C@@H](CC1=CC=CC=C1)NC(OC(C)(C)C)=O)N2CCC[C@H]2C(O)=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |