For research use only. Not for therapeutic Use.
ZD6169(Cat No.:I012101)is an investigational compound developed as a selective inhibitor of the enzyme phosphodiesterase 4 (PDE4), which plays a key role in regulating inflammatory processes by controlling cyclic AMP (cAMP) levels in cells. By inhibiting PDE4, ZD6169 aims to reduce inflammation, making it a potential therapeutic candidate for conditions such as chronic obstructive pulmonary disease (COPD), asthma, and other inflammatory disorders. Preclinical and early clinical studies have demonstrated its ability to modulate immune responses, but further research is needed to fully evaluate its safety, efficacy, and potential for broader therapeutic applications.
CAS Number | 147696-46-6 |
Synonyms | (2S)-N-(4-benzoylphenyl)-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide |
Molecular Formula | C17H14F3NO3 |
Purity | ≥95% |
IUPAC Name | (2S)-N-(4-benzoylphenyl)-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide |
InChI | InChI=1S/C17H14F3NO3/c1-16(24,17(18,19)20)15(23)21-13-9-7-12(8-10-13)14(22)11-5-3-2-4-6-11/h2-10,24H,1H3,(H,21,23)/t16-/m0/s1 |
InChIKey | LVEDGSIMCSQNNX-INIZCTEOSA-N |
SMILES | C[C@](C(=O)NC1=CC=C(C=C1)C(=O)C2=CC=CC=C2)(C(F)(F)F)O |