For research use only. Not for therapeutic Use.
Zebularine(Cat No.:I000041)is a nucleoside analog that serves as a potent inhibitor of DNA methyltransferases, enzymes responsible for adding methyl groups to DNA, which can lead to gene silencing. By inhibiting these enzymes, zebularine reactivates silenced tumor suppressor genes and induces demethylation of genomic DNA. This compound has shown potential anti-cancer effects in various preclinical studies, particularly in solid tumors and hematological malignancies. Zebularine’s ability to modulate epigenetic modifications highlights its promise as a therapeutic agent for cancer treatment, especially in cases with aberrant DNA methylation patterns.
CAS Number | 3690-10-6 |
Synonyms | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
Molecular Formula | C₉H₁₂N₂O₅ |
Purity | ≥95% |
Target | Autophagy |
Solubility | DMSO: ≥ 45 mg/mL |
Storage | 2-8°C |
IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
InChI | InChI=1S/C9H12N2O5/c12-4-5-6(13)7(14)8(16-5)11-3-1-2-10-9(11)15/h1-3,5-8,12-14H,4H2/t5-,6-,7-,8-/m1/s1 |
InChIKey | RPQZTTQVRYEKCR-WCTZXXKLSA-N |
SMILES | C1=CN(C(=O)N=C1)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O |
Reference | <p style=/line-height:25px/> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |