For research use only. Not for therapeutic Use.
Zedoarondiol（Cat No.:I043732）is a bioactive compound derived from the rhizomes of Zingiber zerumbet, a plant in the ginger family. It has shown potential anticancer, anti-inflammatory, and antioxidant properties in various preclinical studies. Zedoarondiol exerts its effects by modulating key cellular pathways, including those involved in apoptosis, oxidative stress, and inflammation. Its ability to inhibit cancer cell growth and reduce inflammation makes it a promising candidate for further research in the treatment of cancer, neurodegenerative diseases, and inflammatory conditions. Zedoarondiol is being investigated for its therapeutic potential in natural product-based drug development.
| CAS Number | 98644-24-7 |
| Synonyms | (3R,3aS,8S,8aR)-3,8-dihydroxy-3,8-dimethyl-5-propan-2-ylidene-1,2,3a,4,7,8a-hexahydroazulen-6-one |
| Molecular Formula | C15H24O3 |
| Purity | ≥95% |
| IUPAC Name | (3R,3aS,8S,8aR)-3,8-dihydroxy-3,8-dimethyl-5-propan-2-ylidene-1,2,3a,4,7,8a-hexahydroazulen-6-one |
| InChI | InChI=1S/C15H24O3/c1-9(2)10-7-12-11(5-6-14(12,3)17)15(4,18)8-13(10)16/h11-12,17-18H,5-8H2,1-4H3/t11-,12+,14-,15+/m1/s1 |
| InChIKey | TXIKNNOOLCGADE-OSRDXIQISA-N |
| SMILES | CC(=C1C[C@H]2[C@@H](CC[C@@]2(C)O)[C@@](CC1=O)(C)O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
