For research use only. Not for therapeutic Use.
Zeylenone(CAT: R072756) is a bioactive natural product with diverse pharmacological activities. Its mode of action involves interacting with specific molecular targets, modulating signaling pathways, and exhibiting antioxidant properties. Zeylenone’s pharmacologic effects encompass anti-inflammatory and potential anticancer activities, making it a subject of research for its therapeutic applications.
| Catalog Number | R072756 |
| CAS Number | 193410-84-3 |
| Molecular Formula | C21H18O7 |
| Purity | ≥95% |
| Target | Apoptosis |
| IUPAC Name | [(1S,5R,6S)-5-benzoyloxy-1,6-dihydroxy-2-oxocyclohex-3-en-1-yl]methyl benzoate |
| InChI | InChI=1S/C21H18O7/c22-17-12-11-16(28-20(25)15-9-5-2-6-10-15)18(23)21(17,26)13-27-19(24)14-7-3-1-4-8-14/h1-12,16,18,23,26H,13H2/t16-,18+,21-/m1/s1 |
| InChIKey | UUNZIGRBVXAOSR-PLMTUMEDSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OCC2(C(C(C=CC2=O)OC(=O)C3=CC=CC=C3)O)O |
