For research use only. Not for therapeutic Use.
Zinc carbonate（Cat No.:L006913）, is a chemical compound represented by the formula ZnCO₃. It is a white, odorless powder that occurs naturally as the mineral smithsonite. This inorganic compound is insoluble in water but soluble in acids, and it is widely used in various industrial applications. Zinc carbonate serves as a pigment in paints, providing corrosion resistance and durability. In the rubber industry, it acts as an activator in the vulcanization process. Additionally, it finds applications in the production of ceramics, cosmetics, and pharmaceuticals.
| Catalog Number | L006913 |
| CAS Number | 3486-35-9 |
| Molecular Formula | ZnCO3 |
| Purity | ≥95% |
| IUPAC Name | zinc;carbonate |
| InChI | InChI=1S/CH2O3.Zn/c2-1(3)4;/h(H2,2,3,4);/q;+2/p-2 |
| InChIKey | FMRLDPWIRHBCCC-UHFFFAOYSA-L |
| SMILES | C(=O)([O-])[O-].[Zn+2] |
