For research use only. Not for therapeutic Use.
Zinc pivalate (Cat.No:M075941) is a chemical compound derived from pivalic acid. It is a coordination complex of zinc, commonly used as a catalyst in organic synthesis, particularly in the formation of carbon-carbon bonds. Zinc pivalate finds applications in various chemical reactions and is valued for its efficiency in catalyzing specific transformations.
CAS Number | 15827-10-8 |
Synonyms | zinc pivalate |
Molecular Formula | C10H18O4Zn |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | zinc;2,2-dimethylpropanoate |
InChI | InChI=1S/2C5H10O2.Zn/c2*1-5(2,3)4(6)7;/h2*1-3H3,(H,6,7);/q;;+2/p-2 |
InChIKey | HQBBDVUXOOMFQN-UHFFFAOYSA-L |
SMILES | CC(C)(C)C(=O)[O-].CC(C)(C)C(=O)[O-].[Zn+2] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |