For research use only. Not for therapeutic Use.
Zinc trifluoroacetate(Cat No.:L006912), is a chemical compound consisting of zinc cations (Zn²⁺) coordinated with trifluoroacetate anions (CF₃COO⁻). It is a white crystalline solid, highly soluble in water and organic solvents. This compound finds applications in various chemical processes, including organic synthesis and catalysis. It catalyzes diverse transformations, such as esterifications and Friedel-Crafts reactions. Zinc trifluoroacetate is a valuable reagent in the preparation of pharmaceuticals, agrochemicals, and specialty chemicals due to its ability to facilitate complex organic reactions. Its role as a catalyst enhances the efficiency of these reactions, making it essential in research and industrial contexts.
CAS Number | 21907-47-1 |
Molecular Formula | C4F6O4Zn |
Purity | ≥95% |
Storage | 4°C |
IUPAC Name | zinc;2,2,2-trifluoroacetate |
InChI | InChI=1S/2C2HF3O2.Zn/c2*3-2(4,5)1(6)7;/h2*(H,6,7);/q;;+2/p-2 |
InChIKey | VCQWRGCXUWPSGY-UHFFFAOYSA-L |
SMILES | C(=O)(C(F)(F)F)[O-].C(=O)(C(F)(F)F)[O-].[Zn+2] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |