For research use only. Not for therapeutic Use.
ZINC00881524(Cat No.:I012027)is a small molecule compound listed in the ZINC database, commonly used in virtual screening and drug discovery research. With a unique molecular structure, ZINC00881524 serves as a potential lead compound in the development of therapeutic agents targeting various biological pathways. Researchers utilize this compound for its ability to interact with key protein targets, making it valuable in the study of enzyme inhibition, receptor modulation, or other biochemical processes. Its versatility in drug design makes it an essential resource for medicinal chemistry and pharmaceutical development efforts.
CAS Number | 557782-81-7 |
Synonyms | ZINC00881524; ZINC-00881524; ZINC 00881524.;N-(4,5-dihydronaphtho[1,2-d]thiazol-2-yl)-2-(3,4-dimethoxyphenyl)acetamide |
Molecular Formula | C₂₁H₂₀N₂O₃S |
Purity | ≥95% |
Target | TGF-beta/Smad |
Solubility | Soluble in DMSO |
Storage | Store at 0-8 °C |
IUPAC Name | N-(4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)-2-(3,4-dimethoxyphenyl)acetamide |
InChI | InChI=1S/C21H20N2O3S/c1-25-16-9-7-13(11-17(16)26-2)12-19(24)22-21-23-20-15-6-4-3-5-14(15)8-10-18(20)27-21/h3-7,9,11H,8,10,12H2,1-2H3,(H,22,23,24) |
InChIKey | DQNMDJGZWFZNHS-UHFFFAOYSA-N |
SMILES | COC1=C(C=C(C=C1)CC(=O)NC2=NC3=C(S2)CCC4=CC=CC=C43)OC |