For research use only. Not for therapeutic Use.
ZINC04574788 is a potent small molecule ligand of miR-21. ZINC04574788 binds to the major groove of miR-21 hairpin conformation.
| Catalog Number | I038705 |
| Synonyms | ZINC-04574788; ZINC 04574788; ZINC04574788 |
| Molecular Formula | C17H14N4O2S |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | (Z)-2-(2-(Phenylcarbamothioyl)hydrazineylidene)-2H-chromene-3-carboxamide |
| InChI | InChI=1S/C17H14N4O2S/c18-15(22)13-10-11-6-4-5-9-14(11)23-16(13)20-21-17(24)19-12-7-2-1-3-8-12/h1-10H,(H2,18,22)(H2,19,21,24)/b20-16- |
| InChIKey | JYGWFZVAEQTBRZ-SILNSSARSA-N |
| SMILES | O=C(C(/C1=N/NC(NC2=CC=CC=C2)=S)=CC3=C(O1)C=CC=C3)N |
