For research use only. Not for therapeutic Use.
ZINC30303842 (CAT: I038719) is an antagonist that targets the interaction between NSD2 (Nuclear Receptor Binding SET Domain Protein 2) and PWWP1 (Proline-Tryptophan-Tryptophan-Proline Domain-Containing 1). NSD2 is a histone methyltransferase involved in chromatin remodeling and gene regulation, while PWWP1 is a protein domain with epigenetic functions.
| Catalog Number | I038719 |
| CAS Number | 1210906-48-1 |
| Synonyms | ZINC30303842; ZINC 30303842; ZINC-30303842; Z336955588; Z 336955588; Z-336955588; NSD2-PWWP1 antagonist 3f; |
| Molecular Formula | C16H14N2OS |
| Purity | 98% |
| Target | Histone Methyltransferase |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 4-cyano-N-cyclopropyl-N-[(thiophen-2-yl)methyl]benzamide |
| InChI | InChI=1S/C16H14N2OS/c17-10-12-3-5-13(6-4-12)16(19)18(14-7-8-14)11-15-2-1-9-20-15/h1-6,9,14H,7-8,11H2 |
| InChIKey | WYAGGMZTARRIDX-UHFFFAOYSA-N |
| SMILES | O=C(N(C1CC1)CC2=CC=CS2)C3=CC=C(C#N)C=C3 |
