For research use only. Not for therapeutic Use.
ZINC69391(Cat No.:I012096)is a selective small-molecule inhibitor of Ras-related C3 botulinum toxin substrate 1 (Rac1), a protein involved in cell migration, cytoskeletal dynamics, and cell growth. By targeting Rac1, ZINC69391 disrupts pathways critical for cancer cell invasion and metastasis, making it a valuable tool in oncology research. Its inhibitory effects on Rac1 activity provide insights into potential therapeutic strategies for treating cancers and other diseases associated with abnormal cell motility. ZINC69391’s specificity makes it an important compound for exploring Rac1-related signaling pathways in cancer biology.
CAS Number | 303094-67-9 |
Synonyms | ZINC-69391; N-(4,6-Dimethyl-2-pyrimidinyl)-N/’-[2-(trifluoromethyl)phenyl]-guanidine |
Molecular Formula | C14H14F3N5 |
Purity | ≥95% |
Target | MAPK/ERK Pathway |
IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)-1-[2-(trifluoromethyl)phenyl]guanidine |
InChI | InChI=1S/C14H14F3N5/c1-8-7-9(2)20-13(19-8)22-12(18)21-11-6-4-3-5-10(11)14(15,16)17/h3-7H,1-2H3,(H3,18,19,20,21,22) |
InChIKey | BEZGMANANMSUSQ-UHFFFAOYSA-N |
SMILES | CC1=CC(=NC(=N1)N=C(N)NC2=CC=CC=C2C(F)(F)F)C |