For research use only. Not for therapeutic Use.
Zineb(CAT: R062231) is an organosulfur compound used as a broad-spectrum fungicide in agriculture. It belongs to the dithiocarbamate class and is effective in protecting crops such as fruits, vegetables, and cereals from fungal diseases like blight, mildew, and rust. Zineb works by inhibiting fungal spore germination, thereby preventing the growth and spread of fungal infections on plants. It is typically applied as a protective spray and is valued for its low toxicity to humans and animals. Despite its effectiveness, environmental concerns about the accumulation of dithiocarbamates in soil and water have led to careful monitoring and regulation of its use.
CAS Number | 12122-67-7 |
Synonyms | [N-[2-[(Dithiocarboxy)amino]ethyl]carbamodithioato(2-)-κS,κS’]-zinc; [[1,2-Ethanediylbis[carbamodithioato]](2-)]-zinc; [Ethylenebis[dithiocarbamato]]-zinc; 1,2-ethanediylbis-carbmodithioic Acid Zinc Complex; Aaphytora; Aphytora; Aspor; Aspor C; Aspor |
Molecular Formula | C₄H₆N₂S₄Zn |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | zinc;N-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate |
InChI | InChI=1S/C4H8N2S4.Zn/c7-3(8)5-1-2-6-4(9)10;/h1-2H2,(H2,5,7,8)(H2,6,9,10);/q;+2/p-2 |
InChIKey | AMHNZOICSMBGDH-UHFFFAOYSA-L |
SMILES | C(CNC(=S)[S-])NC(=S)[S-].[Zn+2] |