For research use only. Not for therapeutic Use.
Zirconium carbonate(Cat No.:M064407) is a chemical compound composed of zirconium, carbon, and oxygen atoms. It is commonly used in various industrial applications, including ceramics, and catalysts, and as a precursor in the production of other zirconium compounds. Zirconium carbonate is valued for its ability to impart desirable properties such as high temperature resistance and chemical stability to materials. Additionally, it finds use in the pharmaceutical industry, particularly in antiperspirants due to its ability to control perspiration.
Catalog Number | M064407 |
CAS Number | 12340-54-4 |
Molecular Formula | C2O6Zr |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | zirconium(4+);dicarbonate |
InChI | InChI=1S/2CH2O3.Zr/c2*2-1(3)4;/h2*(H2,2,3,4);/q;;+4/p-4 |
InChIKey | XJUNLJFOHNHSAR-UHFFFAOYSA-J |
SMILES | C(=O)([O-])[O-].C(=O)([O-])[O-].[Zr+4] |