For research use only. Not for therapeutic Use.
ZLD115(CAT: I041006) is a selective inhibitor of the ZDHHC (zinc finger DHHC-type containing) family of palmitoyltransferases, key enzymes involved in post-translational modification of proteins through palmitoylation. This inhibition disrupts the palmitoylation of proteins critical for cell signaling, membrane trafficking, and protein-protein interactions, leading to altered immune cell function. ZLD115 has shown promising potential in modulating immune responses, particularly in the context of inflammatory diseases such as rheumatoid arthritis and inflammatory bowel disease (IBD). Its targeted action offers a novel approach to regulate excessive inflammation while minimizing off-target effects, making it a valuable candidate for immune modulation and therapeutic interventions.
| CAS Number | 2980653-93-6 |
| Synonyms | 2-[2-chloro-6-cyclopropyl-4-(3,5-dimethyl-1,2-oxazol-4-yl)anilino]-6-(1,4-oxazepan-4-ylmethyl)benzoic acid |
| Molecular Formula | C27H30ClN3O4 |
| Purity | ≥95% |
| IUPAC Name | 2-[2-chloro-6-cyclopropyl-4-(3,5-dimethyl-1,2-oxazol-4-yl)anilino]-6-(1,4-oxazepan-4-ylmethyl)benzoic acid |
| InChI | InChI=1S/C27H30ClN3O4/c1-16-24(17(2)35-30-16)20-13-21(18-7-8-18)26(22(28)14-20)29-23-6-3-5-19(25(23)27(32)33)15-31-9-4-11-34-12-10-31/h3,5-6,13-14,18,29H,4,7-12,15H2,1-2H3,(H,32,33) |
| InChIKey | INIIJQVYGFIRNI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)C2=CC(=C(C(=C2)Cl)NC3=CC=CC(=C3C(=O)O)CN4CCCOCC4)C5CC5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
