For research use only. Not for therapeutic Use.
Zoledronic acid (Cat No.: A000348)is a bisphosphonate drug used primarily to treat bone diseases such as osteoporosis, Paget’s disease, and bone metastases from cancer. It works by inhibiting osteoclast-mediated bone resorption, thereby reducing bone turnover and strengthening bones. Zoledronic acid is administered via intravenous infusion and is effective in preventing fractures and reducing pain in patients with bone-related conditions. It is also used to manage hypercalcemia of malignancy. Potential side effects include kidney toxicity and flu-like symptoms after administration.
| Catalog Number | A000348 |
| CAS Number | 118072-93-8 |
| Synonyms | Zoledronate, CGP-4244 |
| Molecular Formula | C5H10N2O7P2 |
| Purity | ≥95% |
| Target | Autophagy |
| Solubility | Limited solubility |
| Storage | 3 years -20C powder |
| IUPAC Name | (1-hydroxy-2-imidazol-1-yl-1-phosphonoethyl)phosphonic acid |
| InChI | 1S/C5H10N2O7P2/c8-5(15(9,10)11,16(12,13)14)3-7-2-1-6-4-7/h1-2,4,8H,3H2,(H2,9,10,11)(H2,12,13,14) |
| InChIKey | XRASPMIURGNCCH-UHFFFAOYSA-N |
| SMILES | C1=CN(C=N1)CC(O)(P(=O)(O)O)P(=O)(O)O |
