For research use only. Not for therapeutic Use.
Zolimidine（Cat No.:M049026）is a synthetic compound primarily researched for its potential in oncology and immunology. It is an inhibitor that targets specific molecular pathways, aiming to interfere with the progression of cancerous cells and modulate immune responses. Early-stage studies suggest its ability to reduce tumor growth by targeting key signaling proteins. Additionally, Zolimidine may show promise in modulating inflammatory responses, potentially benefiting autoimmune disease therapies. Ongoing research is focused on optimizing its efficacy, understanding its mechanisms, and evaluating its safety profile for broader therapeutic use, particularly in cancer and immune-related conditions.
| CAS Number | 1222-57-7 |
| Synonyms | 2-(4-methylsulfonylphenyl)imidazo[1,2-a]pyridine |
| Molecular Formula | C14H12N2O2S |
| Purity | ≥95% |
| IUPAC Name | 2-(4-methylsulfonylphenyl)imidazo[1,2-a]pyridine |
| InChI | InChI=1S/C14H12N2O2S/c1-19(17,18)12-7-5-11(6-8-12)13-10-16-9-3-2-4-14(16)15-13/h2-10H,1H3 |
| InChIKey | VSLIUWLPFRVCDL-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)C2=CN3C=CC=CC3=N2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
