For research use only. Not for therapeutic Use.
Zoniporide(cas 241800-97-5) is a potent and selective inhibitor of the human sodium-hydrogen exchanger isoform 1 (NHE-1). Zoniporide preserves left ventricular compliance during ventricular fibrillation and minimizes postresuscitation myocardial dysfunction through benefits on energy metabolism. Zoniporide produces clinical, electrophysiologic, and microscopic evidence of peripheral sensory axonopathy and establishes the importance of careful preclinical evaluation of neurological function.
| Catalog Number | I010167 |
| CAS Number | 241800-97-5 |
| Synonyms | CP-597396; CP 597396; CP597396; CP-597,396; CP 597,396; CP597,396; Zoniporide HCl.;N-carbamimidoyl-5-cyclopropyl-1-(quinolin-5-yl)-1H-pyrazole-4-carboxamide hydrochloride |
| Molecular Formula | C17H17ClN6O |
| Purity | ≥95% |
| Target | Na+/H+ Exchanger (NHE) |
| Solubility | Soluble in DMSO, not in water |
| Storage | 0 - 4 °C for short term, or -20 °C for long term |
| InChI | InChI=1S/C17H16N6O.ClH/c18-17(19)22-16(24)12-9-21-23(15(12)10-6-7-10)14-5-1-4-13-11(14)3-2-8-20-13;/h1-5,8-10H,6-7H2,(H4,18,19,22,24);1H |
| InChIKey | JTEXNYIOROVPIR-UHFFFAOYSA-N |
| SMILES | O=C(C1=C(C2CC2)N(C3=C4C=CC=NC4=CC=C3)N=C1)NC(N)=N.[H]Cl |
| Reference | 1: Spasov AA, Gurova, Timofeeva AS, Sorokin SM. [Experimental study of the |
