For research use only. Not for therapeutic Use.
ZSTK474（Cat No.:I003653）is a potent and selective inhibitor of class I phosphoinositide 3-kinase (PI3K), a key enzyme in the PI3K/Akt signaling pathway that regulates cell growth, proliferation, and survival. By inhibiting PI3K, ZSTK474 disrupts tumor growth and induces apoptosis, making it a valuable compound in cancer research. It has shown promising results in preclinical studies, particularly for solid tumors such as lung, breast, and prostate cancers. ZSTK474 is also being explored for its potential to overcome resistance to other cancer therapies, contributing to the development of novel targeted treatments.
| Catalog Number | I003653 |
| CAS Number | 475110-96-4 |
| Synonyms | 4-[4-[2-(difluoromethyl)benzimidazol-1-yl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]morpholine |
| Molecular Formula | C₁₉H₂₁F₂N₇O₂S |
| Purity | ≥95% |
| Target | PI3K |
| Solubility | DMSO ≥20mg/mL Water <1.2mg/mL Ethanol <1.2mg/mL |
| Storage | 3 years -20℃ powder |
| IC50 | 37 nM |
| IUPAC Name | 4-[4-[2-(difluoromethyl)benzimidazol-1-yl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]morpholine |
| InChI | InChI=1S/C19H21F2N7O2/c20-15(21)16-22-13-3-1-2-4-14(13)28(16)19-24-17(26-5-9-29-10-6-26)23-18(25-19)27-7-11-30-12-8-27/h1-4,15H,5-12H2 |
| InChIKey | HGVNLRPZOWWDKD-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=NC(=NC(=N2)N3C4=CC=CC=C4N=C3C(F)F)N5CCOCC5 |
| Reference | <p style=/line-height:25px/> |
