α-Thujene（Cat No.:R033326）is a naturally occurring monoterpene hydrocarbon found in essential oils of various plants, including juniper, eucalyptus, and certain conifers. Known for its characteristic fresh, herbal aroma, it is widely used in the fragrance and flavor industries. In addition to its aromatic properties, α-Thujene has been studied for its potential antimicrobial and anti-inflammatory effects, making it valuable in medicinal and agricultural research. Its high purity and stability ensure reliable results in experimental and commercial applications, contributing to advancements in natural product utilization and therapeutic development.
| Catalog Number | R033326 |
| CAS Number | 2867-05-2 |
| Synonyms | 3-Thujene; 2-Methyl-5-(1-methylethyl)bicyclo[3.1.0]hex-2-ene; (±)-α-Thujene; 2-Methyl-5-isopropylbicyclo[3.1.0]-2-hexene; Origanene; 2-Methyl-5-(1-methylethyl)-bicyclo[3.1.0]hex-2-ene? |
| Molecular Formula | C10H16 |
| Purity | 0% |
| Storage | -20°C |
| IUPAC Name | 4-methyl-1-propan-2-ylbicyclo[3.1.0]hex-3-ene |
| InChI | InChI=1S/C10H16/c1-7(2)10-5-4-8(3)9(10)6-10/h4,7,9H,5-6H2,1-3H3 |
| InChIKey | KQAZVFVOEIRWHN-UHFFFAOYSA-N |
| SMILES | CC1=CCC2(C1C2)C(C)C |
