For research use only. Not for therapeutic Use.
α-Zingiberene (Cat. No: R043124) is a naturally occurring sesquiterpene found predominantly in ginger (Zingiber officinale) and other plants like turmeric. It contributes to the characteristic aroma and flavor of ginger and exhibits various biological activities. α-Zingiberene has been studied for its anti-inflammatory, antioxidant, and anticancer properties, making it a subject of interest in pharmaceutical and nutraceutical research. Additionally, it has shown potential as a natural pesticide due to its insecticidal properties. This compound plays a vital role in flavoring, fragrance, and medicinal applications, particularly in traditional remedies and modern therapeutic research focused on plant-derived bioactives.
CAS Number | 495-60-3 |
Synonyms | (5R)-5-[(1S)-1,5-Dimethyl-4-hexen-1-yl]-2-methyl-1,3-cyclohexadiene; ?[S-(R*,S*)]-5-(1,5-dimethyl-4-hexenyl)-2-methyl-1,3-Cyclohexadiene; (5R)-5-[(1S)-1,5-Dimethyl-4-hexenyl]-2-methyl-1,3-cyclohexadiene; Zingiberene; (-)-Zingiberene; l-Zingiberene; α |
Molecular Formula | C15H24 |
Purity | ≥95% |
Target | Autophagy |
Storage | -20°C |
IUPAC Name | (5R)-2-methyl-5-[(2S)-6-methylhept-5-en-2-yl]cyclohexa-1,3-diene |
InChI | InChI=1S/C15H24/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15/h6,8-10,14-15H,5,7,11H2,1-4H3/t14-,15+/m0/s1 |
InChIKey | KKOXKGNSUHTUBV-LSDHHAIUSA-N |
SMILES | CC1=CCC(C=C1)C(C)CCC=C(C)C |