GW 501516（Cat No.:I003133）, also known as Cardarine, is a selective agonist of the peroxisome proliferator-activated receptor delta (PPARδ). It is primarily researched for its potential to enhance endurance and improve lipid metabolism. By activating PPARδ, GW 501516 increases fatty acid oxidation and energy expenditure, which can reduce body fat and improve physical performance. It has shown promise in treating metabolic disorders such as obesity, diabetes, and dyslipidemia. However, its use in sports is banned due to concerns about its potential long-term effects and risk of tumorigenesis.
| Catalog Number | I003133 |
| CAS Number | 317318-70-0 |
| Synonyms | GW501516; GW-501516; GW 501516; GW1516; GW 1516; GW-1516; GSK-516; GSK 516; GSK516; Endurobol. |
| Molecular Formula | C21H18F3NO3S2 |
| Purity | 95% |
| Target | PPAR |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IC50 | 1 nM(EC50) |
| IUPAC Name | 2-[2-methyl-4-[[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methylsulfanyl]phenoxy]acetic acid |
| InChI | InChI=1S/C21H18F3NO3S2/c1-12-9-16(7-8-17(12)28-10-19(26)27)29-11-18-13(2)25-20(30-18)14-3-5-15(6-4-14)21(22,23)24/h3-9H,10-11H2,1-2H3,(H,26,27) |
| InChIKey | YDBLKRPLXZNVNB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)SCC2=C(N=C(S2)C3=CC=C(C=C3)C(F)(F)F)C)OCC(=O)O |
